C10H9BrF2N2 — CID 107797548
4-bromo-2-(1,1-difluoropropan-2-ylamino)benzonitrile (PubChem CID 107797548) has the molecular formula C10H9BrF2N2 and a molecular weight of 275.10 g/mol. Its IUPAC name is 4-bromo-2-(1,1-difluoropropan-2-ylamino)benzonitrile.
| Compound Name | 4-bromo-2-(1,1-difluoropropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 107797548 |
| Molecular Formula | C10H9BrF2N2 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 4-bromo-2-(1,1-difluoropropan-2-ylamino)benzonitrile |
| SMILES | CC(Nc1cc(Br)ccc1C#N)C(F)F |
| InChI | InChI=1S/C10H9BrF2N2/c1-6(10(12)13)15-9-4-8(11)3-2-7(9)5-14/h2-4,6,10,15H,1H3 |
| InChIKey | PLNYMVAUGVNXSZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |