C10H11BrN2O2 — CID 114901948
4-bromo-2-(1,3-dihydroxypropan-2-ylamino)benzonitrile (PubChem CID 114901948) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is 4-bromo-2-(1,3-dihydroxypropan-2-ylamino)benzonitrile.
| Compound Name | 4-bromo-2-(1,3-dihydroxypropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 114901948 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 4-bromo-2-(1,3-dihydroxypropan-2-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1NC(CO)CO |
| InChI | InChI=1S/C10H11BrN2O2/c11-8-2-1-7(4-12)10(3-8)13-9(5-14)6-15/h1-3,9,13-15H,5-6H2 |
| InChIKey | UNVKITSANVCTBN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |