C16H13ClN4 — CID 107799678
2-[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]-6-methylbenzonitrile (PubChem CID 107799678) has the molecular formula C16H13ClN4 and a molecular weight of 296.76 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]-6-methylbenzonitrile.
| Compound Name | 2-[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107799678 |
| Molecular Formula | C16H13ClN4 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-[2-(chloromethyl)-5-methylimidazo[4,5-b]pyridin-3-yl]-6-methylbenzonitrile |
| SMILES | Cc1ccc2nc(CCl)n(-c3cccc(C)c3C#N)c2n1 |
| InChI | InChI=1S/C16H13ClN4/c1-10-4-3-5-14(12(10)9-18)21-15(8-17)20-13-7-6-11(2)19-16(13)21/h3-7H,8H2,1-2H3 |
| InChIKey | ZJHYOIXNOSPDBY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|