C14H11ClFN5 — CID 79277087
2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-6-fluorobenzonitrile (PubChem CID 79277087) has the molecular formula C14H11ClFN5 and a molecular weight of 303.73 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 79277087 |
| Molecular Formula | C14H11ClFN5 |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]-6-fluorobenzonitrile |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2-c1cccc(F)c1C#N |
| InChI | InChI=1S/C14H11ClFN5/c1-8-13-14(20(2)19-8)21(12(6-15)18-13)11-5-3-4-10(16)9(11)7-17/h3-5H,6H2,1-2H3 |
| InChIKey | IDNPOUPZLBNBAE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|