C15H16ClFN4 — CID 79277389
5-(2-Chloroethyl)-6-(3-fluoro-2-methylphenyl)-1,3-dimethylimidazo[4,5-d]pyrazole (PubChem CID 79277389) has the molecular formula C15H16ClFN4 and a molecular weight of 306.76 g/mol. Its IUPAC name is 5-(2-chloroethyl)-6-(3-fluoro-2-methylphenyl)-1,3-dimethylimidazo[4,5-d]pyrazole.
| Compound Name | 5-(2-Chloroethyl)-6-(3-fluoro-2-methylphenyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 79277389 |
| Molecular Formula | C15H16ClFN4 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-(2-chloroethyl)-6-(3-fluoro-2-methylphenyl)-1,3-dimethylimidazo[4,5-d]pyrazole |
| SMILES | CC1=C(C=CC=C1F)N2C(=NC3=C2N(N=C3C)C)CCCl |
| InChI | InChI=1S/C15H16ClFN4/c1-9-11(17)5-4-6-12(9)21-13(7-8-16)18-14-10(2)19-20(3)15(14)21/h4-6H,7-8H2,1-3H3 |
| InChIKey | YCGCSRPWGQNRIL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 372 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|