C13H12N6O — CID 107801459
N-(2-cyano-3-methylphenyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107801459) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(2-cyano-3-methylphenyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(2-cyano-3-methylphenyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107801459 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(2-cyano-3-methylphenyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cnc(NN)cn2)c1C#N |
| InChI | InChI=1S/C13H12N6O/c1-8-3-2-4-10(9(8)5-14)18-13(20)11-6-17-12(19-15)7-16-11/h2-4,6-7H,15H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | IKCBFRQHZHGAMB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|