C16H13N3S — CID 107804835
3-(1,3-benzothiazol-6-ylamino)-3-phenylpropanenitrile (PubChem CID 107804835) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-ylamino)-3-phenylpropanenitrile.
| Compound Name | 3-(1,3-benzothiazol-6-ylamino)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 107804835 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(1,3-benzothiazol-6-ylamino)-3-phenylpropanenitrile |
| SMILES | N#CCC(Nc1ccc2ncsc2c1)c1ccccc1 |
| InChI | InChI=1S/C16H13N3S/c17-9-8-14(12-4-2-1-3-5-12)19-13-6-7-15-16(10-13)20-11-18-15/h1-7,10-11,14,19H,8H2 |
| InChIKey | PDBFCRCRCUDKAD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |