C12H12BrN3O5 — CID 107810887
2-[1-[(2-bromo-4-nitrophenyl)carbamoyl]azetidin-3-yl]acetic acid (PubChem CID 107810887) has the molecular formula C12H12BrN3O5 and a molecular weight of 358.15 g/mol. Its IUPAC name is 2-[1-[(2-bromo-4-nitrophenyl)carbamoyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2-bromo-4-nitrophenyl)carbamoyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107810887 |
| Molecular Formula | C12H12BrN3O5 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-[1-[(2-bromo-4-nitrophenyl)carbamoyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)Nc2ccc([N+](=O)[O-])cc2Br)C1 |
| InChI | InChI=1S/C12H12BrN3O5/c13-9-4-8(16(20)21)1-2-10(9)14-12(19)15-5-7(6-15)3-11(17)18/h1-2,4,7H,3,5-6H2,(H,14,19)(H,17,18) |
| InChIKey | GMPALDJAMIZPBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|