C14H17BrN2O4 — CID 62689074
2-[1-[(2-bromo-4-nitrophenyl)methyl]piperidin-3-yl]acetic acid (PubChem CID 62689074) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is 2-[1-[(2-bromo-4-nitrophenyl)methyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2-bromo-4-nitrophenyl)methyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 62689074 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-[1-[(2-bromo-4-nitrophenyl)methyl]piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(Cc2ccc([N+](=O)[O-])cc2Br)C1 |
| InChI | InChI=1S/C14H17BrN2O4/c15-13-7-12(17(20)21)4-3-11(13)9-16-5-1-2-10(8-16)6-14(18)19/h3-4,7,10H,1-2,5-6,8-9H2,(H,18,19) |
| InChIKey | XDGPFYJGIRXXMQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|