C14H19BrN2O3 — CID 114510984
1-[(2-bromo-4-nitrophenyl)methyl]-3-ethylpiperidin-4-ol (PubChem CID 114510984) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 1-[(2-bromo-4-nitrophenyl)methyl]-3-ethylpiperidin-4-ol.
| Compound Name | 1-[(2-bromo-4-nitrophenyl)methyl]-3-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 114510984 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 1-[(2-bromo-4-nitrophenyl)methyl]-3-ethylpiperidin-4-ol |
| SMILES | CCC1CN(Cc2ccc([N+](=O)[O-])cc2Br)CCC1O |
| InChI | InChI=1S/C14H19BrN2O3/c1-2-10-8-16(6-5-14(10)18)9-11-3-4-12(17(19)20)7-13(11)15/h3-4,7,10,14,18H,2,5-6,8-9H2,1H3 |
| InChIKey | PZJAITYVJURATG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|