C14H14N4O2S — CID 107811548
5-(4-methylsulfonyl-1H-benzimidazol-2-yl)benzene-1,3-diamine (PubChem CID 107811548) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-(4-methylsulfonyl-1H-benzimidazol-2-yl)benzene-1,3-diamine.
| Compound Name | 5-(4-methylsulfonyl-1H-benzimidazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811548 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-(4-methylsulfonyl-1H-benzimidazol-2-yl)benzene-1,3-diamine |
| SMILES | CS(=O)(=O)c1cccc2[nH]c(-c3cc(N)cc(N)c3)nc12 |
| InChI | InChI=1S/C14H14N4O2S/c1-21(19,20)12-4-2-3-11-13(12)18-14(17-11)8-5-9(15)7-10(16)6-8/h2-7H,15-16H2,1H3,(H,17,18) |
| InChIKey | MFTZCBAPCGPYKJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|