C13H12N2O3S2 — CID 82007938
2-(3-methoxythiophen-2-yl)-4-methylsulfonyl-1H-benzimidazole (PubChem CID 82007938) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(3-methoxythiophen-2-yl)-4-methylsulfonyl-1H-benzimidazole.
| Compound Name | 2-(3-methoxythiophen-2-yl)-4-methylsulfonyl-1H-benzimidazole |
|---|---|
| PubChem CID | 82007938 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-(3-methoxythiophen-2-yl)-4-methylsulfonyl-1H-benzimidazole |
| SMILES | COc1ccsc1-c1nc2c(S(C)(=O)=O)cccc2[nH]1 |
| InChI | InChI=1S/C13H12N2O3S2/c1-18-9-6-7-19-12(9)13-14-8-4-3-5-10(11(8)15-13)20(2,16)17/h3-7H,1-2H3,(H,14,15) |
| InChIKey | MJVFYMUFSBMOFV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |