C11H14N4O3S — CID 107811747
5-[3-(1-methylsulfonylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine (PubChem CID 107811747) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-[3-(1-methylsulfonylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine.
| Compound Name | 5-[3-(1-methylsulfonylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811747 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-[3-(1-methylsulfonylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diamine |
| SMILES | CC(c1noc(-c2cc(N)cc(N)c2)n1)S(C)(=O)=O |
| InChI | InChI=1S/C11H14N4O3S/c1-6(19(2,16)17)10-14-11(18-15-10)7-3-8(12)5-9(13)4-7/h3-6H,12-13H2,1-2H3 |
| InChIKey | WMRFOOCYBROLLW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|