C12H12F3N3O — CID 61235851
3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline (PubChem CID 61235851) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 61235851 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-5-(trifluoromethyl)aniline |
| SMILES | CC(C)c1noc(-c2cc(N)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H12F3N3O/c1-6(2)10-17-11(19-18-10)7-3-8(12(13,14)15)5-9(16)4-7/h3-6H,16H2,1-2H3 |
| InChIKey | DLBLNWKRRDHVOQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|