C13H15F3N4O — CID 116806385
5-[3-amino-5-(trifluoromethyl)phenyl]-N,N-diethyl-1,2,4-oxadiazol-3-amine (PubChem CID 116806385) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 5-[3-amino-5-(trifluoromethyl)phenyl]-N,N-diethyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-[3-amino-5-(trifluoromethyl)phenyl]-N,N-diethyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 116806385 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-[3-amino-5-(trifluoromethyl)phenyl]-N,N-diethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CCN(CC)c1noc(-c2cc(N)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H15F3N4O/c1-3-20(4-2)12-18-11(21-19-12)8-5-9(13(14,15)16)7-10(17)6-8/h5-7H,3-4,17H2,1-2H3 |
| InChIKey | BGIRHASRFAXYMV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|