C21H13F3N2O — CID 25110336
3-phenyl-5-[3-phenyl-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole (PubChem CID 25110336) has the molecular formula C21H13F3N2O and a molecular weight of 366.34 g/mol. Its IUPAC name is 3-phenyl-5-[3-phenyl-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-[3-phenyl-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25110336 |
| Molecular Formula | C21H13F3N2O |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-phenyl-5-[3-phenyl-5-(trifluoromethyl)phenyl]-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1cc(-c2ccccc2)cc(-c2nc(-c3ccccc3)no2)c1 |
| InChI | InChI=1S/C21H13F3N2O/c22-21(23,24)18-12-16(14-7-3-1-4-8-14)11-17(13-18)20-25-19(26-27-20)15-9-5-2-6-10-15/h1-13H |
| InChIKey | TWMOIMKPRRRVIS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |