C16H8F6N2O — CID 25110321
5-[3,5-bis(trifluoromethyl)phenyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 25110321) has the molecular formula C16H8F6N2O and a molecular weight of 358.24 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25110321 |
| Molecular Formula | C16H8F6N2O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1cc(-c2nc(-c3ccccc3)no2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H8F6N2O/c17-15(18,19)11-6-10(7-12(8-11)16(20,21)22)14-23-13(24-25-14)9-4-2-1-3-5-9/h1-8H |
| InChIKey | GVCFJIPEZIBTOL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |