C16H17N3O2 — CID 136994382
3-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol (PubChem CID 136994382) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol.
| Compound Name | 3-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136994382 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-[3-(diethylamino)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol |
| SMILES | CCN(CC)c1noc(-c2cc3ccccc3cc2O)n1 |
| InChI | InChI=1S/C16H17N3O2/c1-3-19(4-2)16-17-15(21-18-16)13-9-11-7-5-6-8-12(11)10-14(13)20/h5-10,20H,3-4H2,1-2H3 |
| InChIKey | YIWNSVALIMPZRF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |