C7H13N3O2 — CID 116808898
[3-(diethylamino)-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 116808898) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is [3-(diethylamino)-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-(diethylamino)-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 116808898 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | [3-(diethylamino)-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | CCN(CC)c1noc(CO)n1 |
| InChI | InChI=1S/C7H13N3O2/c1-3-10(4-2)7-8-6(5-11)12-9-7/h11H,3-5H2,1-2H3 |
| InChIKey | JJXSKUNLQGGMIA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |