C10H20N4O — CID 116806185
N,N-diethyl-5-(propylaminomethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 116806185) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N,N-diethyl-5-(propylaminomethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | N,N-diethyl-5-(propylaminomethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 116806185 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N,N-diethyl-5-(propylaminomethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CCCNCc1nc(N(CC)CC)no1 |
| InChI | InChI=1S/C10H20N4O/c1-4-7-11-8-9-12-10(13-15-9)14(5-2)6-3/h11H,4-8H2,1-3H3 |
| InChIKey | DPAHMJVNJTXICX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|