C9H17N3O — CID 60720301
N-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]propan-1-amine (PubChem CID 60720301) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 60720301 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C9H17N3O/c1-4-5-10-6-8-11-9(7(2)3)12-13-8/h7,10H,4-6H2,1-3H3 |
| InChIKey | VNPACHDQVYJGIJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|