C16H16N2O3 — CID 136965177
3-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol (PubChem CID 136965177) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol.
| Compound Name | 3-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136965177 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]naphthalen-2-ol |
| SMILES | CCC(OC)c1noc(-c2cc3ccccc3cc2O)n1 |
| InChI | InChI=1S/C16H16N2O3/c1-3-14(20-2)15-17-16(21-18-15)12-8-10-6-4-5-7-11(10)9-13(12)19/h4-9,14,19H,3H2,1-2H3 |
| InChIKey | ODTMEVDWPPQOTO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |