C13H16N2O3 — CID 136983308
2-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylphenol (PubChem CID 136983308) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylphenol.
| Compound Name | 2-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylphenol |
|---|---|
| PubChem CID | 136983308 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-[3-(1-methoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylphenol |
| SMILES | CCC(OC)c1noc(-c2cc(C)ccc2O)n1 |
| InChI | InChI=1S/C13H16N2O3/c1-4-11(17-3)12-14-13(18-15-12)9-7-8(2)5-6-10(9)16/h5-7,11,16H,4H2,1-3H3 |
| InChIKey | JOGWNSWJIWISBI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |