C14H19N3O2 — CID 116702014
2-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline (PubChem CID 116702014) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline.
| Compound Name | 2-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
|---|---|
| PubChem CID | 116702014 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
| SMILES | CCOC(CC)c1noc(-c2cc(C)ccc2N)n1 |
| InChI | InChI=1S/C14H19N3O2/c1-4-12(18-5-2)13-16-14(19-17-13)10-8-9(3)6-7-11(10)15/h6-8,12H,4-5,15H2,1-3H3 |
| InChIKey | LGKOVZYRYMFCRK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|