C13H15Cl2N3O2 — CID 116701908
2,4-dichloro-6-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 116701908) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 2,4-dichloro-6-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-dichloro-6-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 116701908 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2,4-dichloro-6-[3-(1-ethoxypropyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CCOC(CC)c1noc(-c2cc(Cl)cc(Cl)c2N)n1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-3-10(19-4-2)12-17-13(20-18-12)8-5-7(14)6-9(15)11(8)16/h5-6,10H,3-4,16H2,1-2H3 |
| InChIKey | RXKKPFJSQLYMDA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|