C14H18Cl2N4O — CID 43331551
2,4-dichloro-6-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 43331551) has the molecular formula C14H18Cl2N4O and a molecular weight of 329.23 g/mol. Its IUPAC name is 2,4-dichloro-6-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-dichloro-6-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 43331551 |
| Molecular Formula | C14H18Cl2N4O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2,4-dichloro-6-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CCN(CC)CCc1noc(-c2cc(Cl)cc(Cl)c2N)n1 |
| InChI | InChI=1S/C14H18Cl2N4O/c1-3-20(4-2)6-5-12-18-14(21-19-12)10-7-9(15)8-11(16)13(10)17/h7-8H,3-6,17H2,1-2H3 |
| InChIKey | RNKIQYBNWNICTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|