C15H11Cl2N3O — CID 43331560
2,4-dichloro-6-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 43331560) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 2,4-dichloro-6-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2,4-dichloro-6-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 43331560 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2,4-dichloro-6-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1ccccc1-c1noc(-c2cc(Cl)cc(Cl)c2N)n1 |
| InChI | InChI=1S/C15H11Cl2N3O/c1-8-4-2-3-5-10(8)14-19-15(21-20-14)11-6-9(16)7-12(17)13(11)18/h2-7H,18H2,1H3 |
| InChIKey | PXRCHGGEKIRNLY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|