C16H12N2O3 — CID 2480918
2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid (PubChem CID 2480918) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid.
| Compound Name | 2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 2480918 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid |
| SMILES | Cc1ccccc1-c1noc(-c2ccccc2C(=O)O)n1 |
| InChI | InChI=1S/C16H12N2O3/c1-10-6-2-3-7-11(10)14-17-15(21-18-14)12-8-4-5-9-13(12)16(19)20/h2-9H,1H3,(H,19,20) |
| InChIKey | DYLRHRSWMBGUMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |