About 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline
2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline (PubChem CID 79613479) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline.
Molecular Properties
| Compound Name | 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
| PubChem CID | 79613479 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline |
| SMILES | COC(C)c1noc(-c2cc(C)ccc2N)n1 |
| InChI | InChI=1S/C12H15N3O2/c1-7-4-5-10(13)9(6-7)12-14-11(15-17-12)8(2)16-3/h4-6,8H,13H2,1-3H3 |
| InChIKey | BKQVIUMFMBLCNY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline?
The IUPAC name of 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline (CID 79613479) is 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline.
What is the SMILES notation for 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline?
The canonical SMILES for 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline is COC(C)c1noc(-c2cc(C)ccc2N)n1.
What is the InChIKey of 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline?
The InChIKey is BKQVIUMFMBLCNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-7-4-5-10(13)9(6-7)12-14-11(15-17-12)8(2)16-3/h4-6,8H,13H2,1-3H3.
What are the key properties of 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline?
2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline has a molecular weight of 233.27 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]-4-methylaniline is sourced from PubChem (CID 79613479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).