C12H13ClN2O3 — CID 167773891
5-(2-chlorophenyl)-3-(1,2-dimethoxyethyl)-1,2,4-oxadiazole (PubChem CID 167773891) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-(1,2-dimethoxyethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-chlorophenyl)-3-(1,2-dimethoxyethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167773891 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-(2-chlorophenyl)-3-(1,2-dimethoxyethyl)-1,2,4-oxadiazole |
| SMILES | COCC(OC)c1noc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H13ClN2O3/c1-16-7-10(17-2)11-14-12(18-15-11)8-5-3-4-6-9(8)13/h3-6,10H,7H2,1-2H3 |
| InChIKey | JMMNHZBLZCQKJZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |