C11H15N5 — CID 107811826
5-(5-propyl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine (PubChem CID 107811826) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 5-(5-propyl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine.
| Compound Name | 5-(5-propyl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811826 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 5-(5-propyl-1H-1,2,4-triazol-3-yl)benzene-1,3-diamine |
| SMILES | CCCc1nc(-c2cc(N)cc(N)c2)n[nH]1 |
| InChI | InChI=1S/C11H15N5/c1-2-3-10-14-11(16-15-10)7-4-8(12)6-9(13)5-7/h4-6H,2-3,12-13H2,1H3,(H,14,15,16) |
| InChIKey | OBFHYPUIVFRUPN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|