C18H18O3S — CID 10781570
(4R,5R)-4-(benzenesulfinyl)-2,2-dimethyl-5-phenyloxolan-3-one (PubChem CID 10781570) has the molecular formula C18H18O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is (4R,5R)-4-(benzenesulfinyl)-2,2-dimethyl-5-phenyloxolan-3-one.
| Compound Name | (4R,5R)-4-(benzenesulfinyl)-2,2-dimethyl-5-phenyloxolan-3-one |
|---|---|
| PubChem CID | 10781570 |
| Molecular Formula | C18H18O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4R,5R)-4-(benzenesulfinyl)-2,2-dimethyl-5-phenyloxolan-3-one |
| SMILES | CC1(C)O[C@H](c2ccccc2)[C@@H](S(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H18O3S/c1-18(2)17(19)16(22(20)14-11-7-4-8-12-14)15(21-18)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3/t15-,16-,22?/m1/s1 |
| InChIKey | HWDADYZQCBACMO-AXJGWOQESA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |