C15H24N4 — CID 107816967
3-(2-ethylhexyl)-7-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 107816967) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-7-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(2-ethylhexyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 107816967 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-(2-ethylhexyl)-7-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | CCCCC(CC)Cn1c(N)nc2c(C)ccnc21 |
| InChI | InChI=1S/C15H24N4/c1-4-6-7-12(5-2)10-19-14-13(18-15(19)16)11(3)8-9-17-14/h8-9,12H,4-7,10H2,1-3H3,(H2,16,18) |
| InChIKey | DGZLVMRNKLXAOF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |