C17H24Cl2N2 — CID 107817122
5-chloro-2-(2-chloroethyl)-1-(2-ethylhexyl)benzimidazole (PubChem CID 107817122) has the molecular formula C17H24Cl2N2 and a molecular weight of 327.30 g/mol. Its IUPAC name is 5-chloro-2-(2-chloroethyl)-1-(2-ethylhexyl)benzimidazole.
| Compound Name | 5-chloro-2-(2-chloroethyl)-1-(2-ethylhexyl)benzimidazole |
|---|---|
| PubChem CID | 107817122 |
| Molecular Formula | C17H24Cl2N2 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-chloro-2-(2-chloroethyl)-1-(2-ethylhexyl)benzimidazole |
| SMILES | CCCCC(CC)Cn1c(CCCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H24Cl2N2/c1-3-5-6-13(4-2)12-21-16-8-7-14(19)11-15(16)20-17(21)9-10-18/h7-8,11,13H,3-6,9-10,12H2,1-2H3 |
| InChIKey | VNEKXBCYFCMGAW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|