C14H25NO3S2 — CID 107818588
5-(hydroxymethyl)-N-(7-methyloctyl)thiophene-2-sulfonamide (PubChem CID 107818588) has the molecular formula C14H25NO3S2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-(7-methyloctyl)thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-(7-methyloctyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107818588 |
| Molecular Formula | C14H25NO3S2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-(hydroxymethyl)-N-(7-methyloctyl)thiophene-2-sulfonamide |
| SMILES | CC(C)CCCCCCNS(=O)(=O)c1ccc(CO)s1 |
| InChI | InChI=1S/C14H25NO3S2/c1-12(2)7-5-3-4-6-10-15-20(17,18)14-9-8-13(11-16)19-14/h8-9,12,15-16H,3-7,10-11H2,1-2H3 |
| InChIKey | DNGKYGPYRSHXLG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|