C12H19NO5S2 — CID 107847683
2-[5-(6-hydroxyhexylsulfamoyl)thiophen-2-yl]acetic acid (PubChem CID 107847683) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[5-(6-hydroxyhexylsulfamoyl)thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-(6-hydroxyhexylsulfamoyl)thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 107847683 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[5-(6-hydroxyhexylsulfamoyl)thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)NCCCCCCO)s1 |
| InChI | InChI=1S/C12H19NO5S2/c14-8-4-2-1-3-7-13-20(17,18)12-6-5-10(19-12)9-11(15)16/h5-6,13-14H,1-4,7-9H2,(H,15,16) |
| InChIKey | SVGVEZFANSJSAI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|