C11H17NO5S2 — CID 113477021
2-[5-(2-ethoxypropylsulfamoyl)thiophen-2-yl]acetic acid (PubChem CID 113477021) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[5-(2-ethoxypropylsulfamoyl)thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-(2-ethoxypropylsulfamoyl)thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 113477021 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-[5-(2-ethoxypropylsulfamoyl)thiophen-2-yl]acetic acid |
| SMILES | CCOC(C)CNS(=O)(=O)c1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C11H17NO5S2/c1-3-17-8(2)7-12-19(15,16)11-5-4-9(18-11)6-10(13)14/h4-5,8,12H,3,6-7H2,1-2H3,(H,13,14) |
| InChIKey | GJOVNBWTTUWMHC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |