C12H20N2O5S2 — CID 62844503
2-[5-[2-[2-methoxyethyl(methyl)amino]ethylsulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 62844503) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[5-[2-[2-methoxyethyl(methyl)amino]ethylsulfamoyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[2-[2-methoxyethyl(methyl)amino]ethylsulfamoyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 62844503 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[5-[2-[2-methoxyethyl(methyl)amino]ethylsulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | COCCN(C)CCNS(=O)(=O)c1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-14(7-8-19-2)6-5-13-21(17,18)12-4-3-10(20-12)9-11(15)16/h3-4,13H,5-9H2,1-2H3,(H,15,16) |
| InChIKey | ADWXVFKJRKLVSD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |