C14H24N2O4S2 — CID 113053362
N-[2-[(5-ethylthiophen-2-yl)sulfonylamino]ethyl]-N-(3-methoxypropyl)acetamide (PubChem CID 113053362) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-[(5-ethylthiophen-2-yl)sulfonylamino]ethyl]-N-(3-methoxypropyl)acetamide.
| Compound Name | N-[2-[(5-ethylthiophen-2-yl)sulfonylamino]ethyl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 113053362 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[2-[(5-ethylthiophen-2-yl)sulfonylamino]ethyl]-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCN(CCCOC)C(C)=O)s1 |
| InChI | InChI=1S/C14H24N2O4S2/c1-4-13-6-7-14(21-13)22(18,19)15-8-10-16(12(2)17)9-5-11-20-3/h6-7,15H,4-5,8-11H2,1-3H3 |
| InChIKey | VOCJTFJUMOVABQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|