C13H25N3O2S — CID 107820071
1-(2-ethylhexylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 107820071) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-(2-ethylhexylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-(2-ethylhexylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 107820071 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-(2-ethylhexylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | CCCCC(CC)CNCC(O)COc1cnsn1 |
| InChI | InChI=1S/C13H25N3O2S/c1-3-5-6-11(4-2)7-14-8-12(17)10-18-13-9-15-19-16-13/h9,11-12,14,17H,3-8,10H2,1-2H3 |
| InChIKey | LNMNKNKRTSNPSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |