C11H21N3O3S — CID 61171244
1-(2-butoxyethylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 61171244) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-(2-butoxyethylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-(2-butoxyethylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 61171244 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(2-butoxyethylamino)-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | CCCCOCCNCC(O)COc1cnsn1 |
| InChI | InChI=1S/C11H21N3O3S/c1-2-3-5-16-6-4-12-7-10(15)9-17-11-8-13-18-14-11/h8,10,12,15H,2-7,9H2,1H3 |
| InChIKey | MCMZCZHGNJQCST-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|