C11H14BrN3O2S2 — CID 106047152
1-[2-(5-bromothiophen-2-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 106047152) has the molecular formula C11H14BrN3O2S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106047152 |
| Molecular Formula | C11H14BrN3O2S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | OC(CNCCc1ccc(Br)s1)COc1cnsn1 |
| InChI | InChI=1S/C11H14BrN3O2S2/c12-10-2-1-9(18-10)3-4-13-5-8(16)7-17-11-6-14-19-15-11/h1-2,6,8,13,16H,3-5,7H2 |
| InChIKey | VJKJJMFUZBFBMH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|