C10H16N6O2S — CID 63332663
1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol (PubChem CID 63332663) has the molecular formula C10H16N6O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol.
| Compound Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 63332663 |
| Molecular Formula | C10H16N6O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]-3-(1,2,5-thiadiazol-3-yloxy)propan-2-ol |
| SMILES | Cn1cnnc1CCNCC(O)COc1cnsn1 |
| InChI | InChI=1S/C10H16N6O2S/c1-16-7-12-14-9(16)2-3-11-4-8(17)6-18-10-5-13-19-15-10/h5,7-8,11,17H,2-4,6H2,1H3 |
| InChIKey | ILMWBZHDKPSMCR-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|