C12H15NO6 — CID 107820212
(2S)-5-methoxy-2-[(3-methylfuran-2-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 107820212) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is (2S)-5-methoxy-2-[(3-methylfuran-2-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-methoxy-2-[(3-methylfuran-2-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820212 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2S)-5-methoxy-2-[(3-methylfuran-2-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1occc1C)C(=O)O |
| InChI | InChI=1S/C12H15NO6/c1-7-5-6-19-10(7)11(15)13-8(12(16)17)3-4-9(14)18-2/h5-6,8H,3-4H2,1-2H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | KCTNVBZEIPKMOH-QMMMGPOBSA-N |
| XLogP | 0.72 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |