C13H17NO6 — CID 107039288
(2S)-5-ethoxy-2-[(2-methylfuran-3-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 107039288) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is (2S)-5-ethoxy-2-[(2-methylfuran-3-carbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-ethoxy-2-[(2-methylfuran-3-carbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107039288 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (2S)-5-ethoxy-2-[(2-methylfuran-3-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccoc1C)C(=O)O |
| InChI | InChI=1S/C13H17NO6/c1-3-19-11(15)5-4-10(13(17)18)14-12(16)9-6-7-20-8(9)2/h6-7,10H,3-5H2,1-2H3,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | ULTCQNJIYCKQGZ-JTQLQIEISA-N |
| XLogP | 1.11 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |