C21H23N3O4S — CID 1078217
N-(2,4-dimethoxyphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 1078217) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 1078217 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2cnc3sc4c(c3c2=O)CC[C@@H](C)C4)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-12-4-6-14-17(8-12)29-20-19(14)21(26)24(11-22-20)10-18(25)23-15-7-5-13(27-2)9-16(15)28-3/h5,7,9,11-12H,4,6,8,10H2,1-3H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | WGYBBJCLNMRPFO-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |