C24H28N4O5S — CID 22333756
N-(2,4-dimethoxyphenyl)-4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]butanamide (PubChem CID 22333756) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]butanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 22333756 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-[[2-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetyl]amino]butanamide |
| SMILES | COc1ccc(NC(=O)CCCNC(=O)Cn2cnc3sc4c(c3c2=O)CCCC4)c(OC)c1 |
| InChI | InChI=1S/C24H28N4O5S/c1-32-15-9-10-17(18(12-15)33-2)27-20(29)8-5-11-25-21(30)13-28-14-26-23-22(24(28)31)16-6-3-4-7-19(16)34-23/h9-10,12,14H,3-8,11,13H2,1-2H3,(H,25,30)(H,27,29) |
| InChIKey | ZRSQGYPVEPEPPV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|