C16H21NO4S — CID 10782184
(3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one (PubChem CID 10782184) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one.
| Compound Name | (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10782184 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxolan-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H](Sc2ccccc2N)[C@@H]2CCOC2=O)O1 |
| InChI | InChI=1S/C16H21NO4S/c1-16(2)20-9-12(21-16)14(10-7-8-19-15(10)18)22-13-6-4-3-5-11(13)17/h3-6,10,12,14H,7-9,17H2,1-2H3/t10-,12+,14-/m0/s1 |
| InChIKey | SKJMRAGHAXHGPE-SUHUHFCYSA-N |
| XLogP | 2.44 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|