C17H23NO4S — CID 15471498
(3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one (PubChem CID 15471498) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one.
| Compound Name | (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one |
|---|---|
| PubChem CID | 15471498 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3R)-3-[(S)-(2-aminophenyl)sulfanyl-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one |
| SMILES | CC1(C)OC[C@@H]([C@@H](Sc2ccccc2N)[C@@H]2CCCOC2=O)O1 |
| InChI | InChI=1S/C17H23NO4S/c1-17(2)21-10-13(22-17)15(11-6-5-9-20-16(11)19)23-14-8-4-3-7-12(14)18/h3-4,7-8,11,13,15H,5-6,9-10,18H2,1-2H3/t11-,13-,15-/m0/s1 |
| InChIKey | OUDCARJPJMTVDG-WHOFXGATSA-N |
| XLogP | 2.83 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|