C18H27NO3S — CID 101063881
(2R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one (PubChem CID 101063881) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is (2R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 101063881 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
| SMILES | CC[C@@H](Sc1ccccc1N)C1C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C18H27NO3S/c1-6-13(23-14-10-8-7-9-12(14)19)15-11(2)21-17(18(3,4)5)22-16(15)20/h7-11,13,15,17H,6,19H2,1-5H3/t11-,13-,15?,17-/m1/s1 |
| InChIKey | RFCMFZQUKGRMSJ-QVSOCAPDSA-N |
| XLogP | 4.09 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|